Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-[3-(1-Aminoethyl)-2-methylphenyl]-2-methoxyethanimidamide |
|---|---|
| Synonyms | N-(3-(1-aminoethyl)-2-methylphenyl)-2-methoxyacetimidamide |
| Molecular Structure | ![CAS#: 784121-55-7， N-[3-(1-Aminoethyl)-2-methylphenyl]-2-methoxyethanimidamide](/moreStructures/784121-55-7.gif) |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 |
| CAS Registry Number | 784121-55-7 |
| SMILES | Cc1c(cccc1NC(=N)COC)C(C)N |
| InChI | 1S/C12H19N3O/c1-8-10(9(2)13)5-4-6-11(8)15-12(14)7-16-3/h4-6,9H,7,13H2,1-3H3,(H2,14,15) |
| InChIKey | PQIMZXGHROTQAI-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.056°C at 760 mmHg (Cal.) |
| Flash point | 140.712°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[3-(1-Aminoethyl)-2-methylphenyl]-2-methoxyethanimidamide |