Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-3-[(trimethylsilyl)ethynyl]cyclopentanone |
|---|---|
| Synonyms | 2-methyl-3-((trimethylsilyl)ethynyl)cyclopentanone; CYCLOPENT |
| Molecular Structure | ![CAS#: 794523-86-7， 2-Methyl-3-[(trimethylsilyl)ethynyl]cyclopentanone](/moreStructures/794523-86-7.gif) |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 |
| CAS Registry Number | 794523-86-7 |
| SMILES | O=C1C(C)C(C#C[Si](C)(C)C)CC1 |
| InChI | 1S/C11H18OSi/c1-9-10(5-6-11(9)12)7-8-13(2,3)4/h9-10H,5-6H2,1-4H3 |
| InChIKey | RGFPNTJBKVBOIE-UHFFFAOYSA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.387°C at 760 mmHg (Cal.) |
| Flash point | 95.554°C (Cal.) |
| Refractive index | 1.465 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-[(trimethylsilyl)ethynyl]cyclopentanone |