Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Methyl-3-(phenylsulfonyl)bicyclo[1.1.1]pentane |
|---|---|
| Synonyms | 1-methyl-3-(phenylsulfonyl)bicyclo[1.1.1]pentane |
| Molecular Structure | ![CAS#: 796963-38-7， 1-Methyl-3-(phenylsulfonyl)bicyclo[1.1.1]pentane](/moreStructures/796963-38-7.gif) |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.30 |
| CAS Registry Number | 796963-38-7 |
| SMILES | CC12CC(C1)(C2)S(=O)(=O)c3ccccc3 |
| InChI | 1S/C12H14O2S/c1-11-7-12(8-11,9-11)15(13,14)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | CISFSGDNNLLTOG-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.452°C at 760 mmHg (Cal.) |
| Flash point | 210.404°C (Cal.) |
| Refractive index | 1.631 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-(phenylsulfonyl)bicyclo[1.1.1]pentane |