Online Database of Chemicals from Around the World
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (852) 3060-6658 | |||
 |
market19@leapchem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | 17alpha-Hydroxytrenbolone |
|---|---|
| Synonyms | Estra-4,9,11-Trien-3-One, 17-Hydroxy-, (17-Alpha)-; 17-Alpha-Trenbolone; 17Alpha-Hydroxytrenbolone |
| Molecular Structure |  |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 80657-17-6 |
| SMILES | [C@@H]23CCC1=CC(CCC1=C2C=C[C@]4([C@H]3CC[C@H]4O)C)=O |
| InChI | 1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | MEHHPFQKXOUFFV-XDNAFOTISA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.755°C at 760 mmHg (Cal.) |
| Flash point | 208.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17alpha-Hydroxytrenbolone |