Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Cyano-1-benzofuran-2-carbonyl chloride |
|---|---|
| Synonyms | 5-cyanobenzofuran-2-carbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C10H4ClNO2 |
| Molecular Weight | 205.60 |
| CAS Registry Number | 84102-83-0 |
| SMILES | ClC(=O)c1cc2cc(ccc2o1)C#N |
| InChI | 1S/C10H4ClNO2/c11-10(13)9-4-7-3-6(5-12)1-2-8(7)14-9/h1-4H |
| InChIKey | OINOFWLOTVBPOC-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.75°C at 760 mmHg (Cal.) |
| Flash point | 162.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Cyano-1-benzofuran-2-carbonyl chloride |