Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (Z)-Hex-3-Enyl Pivalate |
|---|---|
| Synonyms | 2,2-Dimethylpropanoic Acid [(E)-Hex-3-Enyl] Ester; 2,2-Dimethylpropionic Acid [(E)-Hex-3-Enyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 84604-59-1 |
| EINECS | 283-340-4 |
| SMILES | C(OC(=O)C(C)(C)C)C\C=C\CC |
| InChI | 1S/C11H20O2/c1-5-6-7-8-9-13-10(12)11(2,3)4/h6-7H,5,8-9H2,1-4H3/b7-6+ |
| InChIKey | JGXBXELJDMGEAB-VOTSOKGWSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.523°C at 760 mmHg (Cal.) |
| Flash point | 75.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-Hex-3-Enyl Pivalate |