Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,3-Dimethyl-1-(trifluoroacetyl)-2-aziridinone |
|---|---|
| Synonyms | 3,3-dimethyl-1-(2,2,2-trifluoroacetyl)aziridin-2-one |
| Molecular Structure |  |
| Molecular Formula | C6H6F3NO2 |
| Molecular Weight | 181.11 |
| CAS Registry Number | 84758-80-5 |
| SMILES | CC1(C(=O)N1C(=O)C(F)(F)F)C |
| InChI | 1S/C6H6F3NO2/c1-5(2)3(11)10(5)4(12)6(7,8)9/h1-2H3 |
| InChIKey | YOWWYJBPYCWVDC-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 107.847°C at 760 mmHg (Cal.) |
| Flash point | 19.026°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-1-(trifluoroacetyl)-2-aziridinone |