|
CAS#: 87249-11-4 Product: Ethyl [(1S)-8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl]acetate No suppilers available for the product. |
| Name | Ethyl [(1S)-8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl]acetate |
|---|---|
| Synonyms | (+)-Etodolic acid; BRN 5761988; RAK-592 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.35 |
| CAS Registry Number | 87249-11-4 |
| SMILES | O=C(OCC)C[C@@H]3OCCc2c3nc1c(cccc12)CC |
| InChI | 1S/C17H21NO3/c1-3-11-6-5-7-12-13-8-9-21-14(10-15(19)20-4-2)17(13)18-16(11)12/h5-7,14,18H,3-4,8-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | LWEXZSRSAUWKGZ-AWEZNQCLSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.585°C at 760 mmHg (Cal.) |
| Flash point | 227.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl [(1S)-8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl]acetate |