Online Database of Chemicals from Around the World
|
CAS#: 884500-75-8 Product: 2-(3-Fluoro-4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one No suppilers available for the product. |
| Name | 2-(3-Fluoro-4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one |
|---|---|
| Synonyms | 2-(3-Fluoro-4-hydroxy-phenyl)-pyrano[2,3-b]pyridin-4-one |
| Molecular Structure | ![CAS#: 884500-75-8， 2-(3-Fluoro-4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one](/moreStructures/884500-75-8.gif) |
| Molecular Formula | C14H8FNO3 |
| Molecular Weight | 257.22 |
| CAS Registry Number | 884500-75-8 |
| SMILES | Fc3c(O)ccc(C=2Oc1ncccc1C(=O)C=2)c3 |
| InChI | 1S/C14H8FNO3/c15-10-6-8(3-4-11(10)17)13-7-12(18)9-2-1-5-16-14(9)19-13/h1-7,17H |
| InChIKey | GRZRBMWDXZEEMX-UHFFFAOYSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.023°C at 760 mmHg (Cal.) |
| Flash point | 220.523°C (Cal.) |
| Refractive index | 1.654 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Fluoro-4-hydroxyphenyl)-4H-pyrano[2,3-b]pyridin-4-one |