Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1,1-Trichloro-2-methyl-2-propanyl carbamate |
|---|---|
| Synonyms | 1,1,1-trichloro-2-methylpropan-2-yl carbamate |
| Molecular Structure |  |
| Molecular Formula | C5H8Cl3NO2 |
| Molecular Weight | 220.48 |
| CAS Registry Number | 89416-45-5 |
| SMILES | ClC(Cl)(Cl)C(C)(C)OC(=O)N |
| InChI | 1S/C5H8Cl3NO2/c1-4(2,5(6,7)8)11-3(9)10/h1-2H3,(H2,9,10) |
| InChIKey | DFNJPPOAVCXQQQ-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.919°C at 760 mmHg (Cal.) |
| Flash point | 121.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trichloro-2-methyl-2-propanyl carbamate |