Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N3,N3-Diethylfuro[2,3-d][1,2]oxazole-3,5-diamine 2-oxide |
|---|---|
| Synonyms | 5-amino-3-(diethylamino)furo[2,3-d]isoxazole 2-oxide |
| Molecular Structure | ![CAS#: 897938-71-5， N<sup>3</sup>,N<sup>3</sup>-Diethylfuro[2,3-d][1,2]oxazole-3,5-diamine 2-oxide](/moreStructures/897938-71-5.gif) |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 897938-71-5 |
| SMILES | CCN(CC)c1c2c(cc(o2)N)o[n+]1[O-] |
| InChI | 1S/C9H13N3O3/c1-3-11(4-2)9-8-6(15-12(9)13)5-7(10)14-8/h5H,3-4,10H2,1-2H3 |
| InChIKey | NUBMWBWRUFTGRJ-UHFFFAOYSA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.659°C at 760 mmHg (Cal.) |
| Flash point | 174.944°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N3,N3-Diethylfuro[2,3-d][1,2]oxazole-3,5-diamine 2-oxide |