Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 8-Amino-5-quinoxalinol 1-oxide |
|---|---|
| Synonyms | 8-amino-5-hydroxyquinoxaline 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 899449-30-0 |
| SMILES | c1cc(c2c(c1N)[n+](ccn2)[O-])O |
| InChI | 1S/C8H7N3O2/c9-5-1-2-6(12)7-8(5)11(13)4-3-10-7/h1-4,12H,9H2 |
| InChIKey | HAEVFVRIVIGSMO-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.841°C at 760 mmHg (Cal.) |
| Flash point | 261.538°C (Cal.) |
| Refractive index | 1.742 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Amino-5-quinoxalinol 1-oxide |