Online Database of Chemicals from Around the World
|
CAS#: 943-39-5 Product: 4-Nitroperoxybenzoic acid No suppilers available for the product. |
| Name | 4-Nitroperoxybenzoic acid |
|---|---|
| Synonyms | 4-Nitroperbenzoic Acid; 4-09-00-01189 (Beilstein Handbook Reference); Brn 1075774 |
| Molecular Structure |  |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 |
| CAS Registry Number | 943-39-5 |
| EINECS | 213-401-2 |
| SMILES | C1=C(C=CC(=C1)[N+](=O)[O-])C(OO)=O |
| InChI | 1S/C7H5NO5/c9-7(13-12)5-1-3-6(4-2-5)8(10)11/h1-4,12H |
| InChIKey | ZJAFQAPHWPSKRZ-UHFFFAOYSA-N |
| Density | 1.524g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.43°C at 760 mmHg (Cal.) |
| Flash point | 184.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitroperoxybenzoic acid |