|
CAS#: 98533-25-6 Product: N,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxamide No suppilers available for the product. |
| Name | N,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| Synonyms | N-methyl(5-methyl-1-phenylpyrazol-4-yl)carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.25 |
| CAS Registry Number | 98533-25-6 |
| SMILES | CNC(=O)c2cnn(c1ccccc1)c2C |
| InChI | 1S/C12H13N3O/c1-9-11(12(16)13-2)8-14-15(9)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16) |
| InChIKey | YGIKCRJKEYCSAZ-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.478°C at 760 mmHg (Cal.) |
| Flash point | 192.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxamide |