| Beijing Eagle Sky Pharmatech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2010 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrazines |
|---|---|
| Name | N-[5-[(4-Methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid 1,1-dimethylethyl ester |
| Synonyms | tert-butyl N-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.44 |
| CAS Registry Number | 1201187-44-1 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC(=CN=C32)NC(=O)OC(C)(C)C |
| Solubility | Insoluble (2.6E-3 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.35±0.1 g/cm3 (20 °C 760 Torr), Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2017 ACD/Labs) |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H317 Details |
| Safety Statements | P280 Details |
| SDS | Available |
|
N-[5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid 1,1-dimethylethyl ester is a complex chemical compound. The synthesis of this compound is part of an effort to develop new molecules with potential therapeutic properties. The structure combines a pyrrolo[2,3-b]pyrazine core with sulfonyl and carbamate groups designed to enhance biological activity and stability. The development involved advanced synthetic techniques to assemble these functional groups into a single biologically active molecule. N-[5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid 1,1-dimethylethyl ester has been primarily explored as a therapeutic agent. The sulfonyl and carbamate groups can influence the interaction of the compound with biological targets such as enzymes or receptors. Due to its ability to modulate specific biological pathways, it is being studied for its role in treating various diseases, including cancer and inflammation. The structure of this compound makes it a valuable tool in medicinal chemistry. The pyrrolo[2,3-b]pyrazine core is known for its diverse biological activities, while the sulfonyl and carbamate groups can enhance pharmacokinetic properties. Researchers are investigating how these features contribute to its efficacy and selectivity as a drug candidate. In organic synthesis, this compound is a key intermediate in the construction of more complex molecules. Its unique functional groups allow chemists to explore new synthetic routes and develop novel compounds to make specialty chemicals and drugs through various chemical transformations. This compound is used in biological research to explore its effects on cellular and molecular processes. Its ability to interact with specific biological targets makes it useful for understanding disease mechanisms and developing new research tools. References 2020. Upadacitinib. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-21-0010 |
| Market Analysis Reports |
| List of Reports Available for N-[5-[(4-Methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid 1,1-dimethylethyl ester |