Online Database of Chemicals from Around the World

Hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride (1:1)
[CAS# 1383132-15-7]

List of Suppliers
Amadis Chemical Co., Ltd. China
www.amadischem.com
+86 (571) 8992-5085
+86 (571) 8992-5065
sales@amadischem.com
Chemical manufacturer since 2010
chemBlink Standard supplier since 2015
Xi'an Tuochao Biotechnology Co., Ltd. China
www.xatuochao.cn
+86 18092957403
chen.zeshan@xatuochao.com
QQ Chat
Skype Chat
WeChat: +8618092957403
WhatsApp:+8618092957403
Chemical manufacturer since 2017
chemBlink Standard supplier since 2023

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives
NameHexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride (1:1)
Synonymsmethyl azepane-4-carboxylate hydrochloride
Molecular StructureCAS # 1383132-15-7, Hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride (1:1)
Molecular FormulaC8H15NO2.HCl
Molecular Weight193.67
CAS Registry Number1383132-15-7
EC Number867-207-3
SMILESCOC(=O)C1CCCNCC1.Cl
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2AH319
Skin irritationSkin Irrit.2H315
SDSAvailable
up Discovery and Applications
Hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride is an intriguing compound within the field of organic chemistry, characterized by a saturated azepine ring and a carboxylic acid derivative. This compound, with the molecular formula C8H14ClN O2, has garnered attention due to its potential applications in medicinal chemistry and material science.

The discovery of hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride is rooted in the exploration of cyclic amines and their derivatives. Azepines are seven-membered heterocyclic compounds that exhibit unique properties, making them valuable in drug development. The specific structure of this compound combines the stability of the saturated azepine ring with the reactivity of a carboxylic acid, offering diverse functionalization possibilities. Researchers have been focused on synthesizing various azepine derivatives to study their biological activities and potential therapeutic applications.

One of the primary applications of hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride lies in medicinal chemistry, particularly in the development of pharmaceuticals. The azepine scaffold is known to exhibit various biological activities, including antibacterial, antiviral, and anti-inflammatory properties. The introduction of the carboxylic acid moiety enhances the compound's solubility and bioavailability, making it an attractive candidate for drug formulation. Researchers have investigated its potential as a lead compound for developing new medications targeting a range of diseases, including neurodegenerative disorders and infections.

Additionally, the compound serves as a valuable intermediate in organic synthesis. Its reactivity allows for the introduction of various functional groups, which can lead to the creation of more complex molecules. This synthetic versatility is particularly advantageous in the pharmaceutical industry, where the ability to modify chemical structures can lead to the discovery of novel drug candidates. The methyl ester group can be hydrolyzed to produce the corresponding carboxylic acid, further expanding its utility in synthetic pathways.

Moreover, hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride has potential applications in materials science. The azepine ring structure provides a foundation for developing advanced materials, such as polymers and coatings. The compound's ability to undergo various chemical modifications can be harnessed to tailor material properties, including thermal stability and mechanical strength. Researchers are exploring its incorporation into polymeric systems to enhance their performance in specific applications, such as adhesives and sealants.

In summary, hexahydro-1H-azepine-4-carboxylic acid methyl ester hydrochloride is a significant compound with promising applications in both medicinal chemistry and materials science. Its unique structure, combined with its reactivity, positions it as a valuable building block for the synthesis of bioactive molecules and advanced materials. Ongoing research is expected to uncover further applications and enhance our understanding of this versatile compound.

References

none
Market Analysis Reports
Related Products
(4aR,9R,9aR)-1,...  Hexahydro-1H-Az...  Hexahydro-1H-az...  Hexahydro-1H-az...  Hexahydro-1H-Az...  Hexahydro-1H-Az...  Hexahydro-1H-Az...  Hexahydro-1H-az...  Hexahydro-1H-Az...  Hexahydro-1H-az...  Hexahydro-1H-az...  Hexahydro-1H-az...  Hexahydro-1H-az...  Hexahydro-1H-Az...  (3S,4S,5S,6S)-H...  Hexahydro-1H-az...  Hexahydro-1H-az...  Hexahydro-2H-Az...  Hexahydro-2H-Az...  Hexahydro-2H-Az...