| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Cimicoxib |
|---|---|
| Synonyms | 4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13ClFN3O3S |
| Molecular Weight | 381.81 |
| CAS Registry Number | 265114-23-6 |
| EC Number | 642-922-1 |
| SMILES | COC1=C(C=C(C=C1)C2=C(N=CN2C3=CC=C(C=C3)S(=O)(=O)N)Cl)F |
| Solubility | 13.5 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.650, Calc.* |
| Melting point | 243.16 °C |
| Boiling Point | 565.43 °C, 593.1±60.0 °C (760 mmHg), Calc.* |
| Flash Point | 312.5±32.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H317-H318-H334 Details | ||||||||||||||||||||||||||||||||||||||||
| Safety Statements | P203-P260-P261-P264-P264+P265-P270-P271-P272-P273-P280-P281-P284-P302+P352-P304+P340-P305+P354+P338-P308+P316-P317-P318-P319-P321-P332+P317-P333+P313-P342+P316-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Cimicoxib |