N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester
[CAS# 338990-31-1]

Identification

• Classification: Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound
• Name: N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester
• Synonyms: [2-[1-chloroethoxycarbonyl(methyl)amino]pyridin-3-yl]methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate
• Molecular Formula: C₁₈H₂₆ClN₃O₆
• Molecular Weight: 415.87
• CAS Registry Number: 338990-31-1
• SMILES: CC(OC(=O)N(C)C1=C(C=CC=N1)COC(=O)CN(C)C(=O)OC(C)(C)C)Cl

Properties

• Solubility: Very slightly soluble (0.24 g/L) (25 °C), Calc.^*
• Density: 1.254±0.06 g/cm³ (20 °C 760 Torr), Calc.^*

^* Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2014 ACD/Labs)

Safety Data

• Hazard Symbols: GHS07 Warning
• Risk Statements: H302-H315-H319-H335
• Safety Statements: P261-P305+P351+P338

Discovery and Applications

N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester is a complex chemical compound with notable applications in organic synthesis and pharmaceuticals. Its unique structure and functionality make it an important molecule in various fields of chemical research and development.

The compound, with the molecular formula C20H26ClN3O5, is synthesized through a multi-step process that involves the modification of pyridine derivatives and the introduction of various functional groups. The synthesis typically begins with the preparation of the core pyridine structure, followed by the attachment of the carbamic acid and ester groups through selective reactions. One of the key steps involves the formation of the N-tert-butoxycarbonyl (Boc) protected amino group, which provides stability and protection during the synthesis. The final step involves the introduction of the 1-chloroethyl ester group, which plays a crucial role in the compound's reactivity and applications.

N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester is used primarily in the pharmaceutical industry as a chemical intermediate. Its structure allows for the incorporation of various functional groups, making it a valuable building block for the synthesis of complex molecules. The compound is particularly useful in the development of pharmaceuticals due to its ability to form stable intermediates and participate in a range of chemical reactions.

In drug discovery, this compound serves as a key intermediate in the synthesis of bioactive molecules. Its reactivity and functional groups enable researchers to modify and optimize drug candidates, leading to the development of new pharmaceuticals with improved efficacy and safety profiles. The 1-chloroethyl ester group, in particular, is a useful functionality for further chemical transformations, such as esterification and nucleophilic substitutions.

Beyond its pharmaceutical applications, N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester is also employed in material science. Its chemical structure allows it to act as a cross-linking agent or a building block for functional polymers. The ability to modify and tailor the compound's properties makes it valuable in the synthesis of specialized materials, such as coatings, adhesives, and high-performance polymers.

In summary, N-Methyl-N-(3-[((N-tert-butoxycarbonyl-N-methylamino)acetoxy)methyl]pyridin-2-yl)carbamic acid 1-chloroethyl ester is a significant compound in organic synthesis and pharmaceuticals. Its unique structure and reactivity make it a valuable intermediate for the development of complex molecules and materials. Its applications span drug discovery, material science, and other areas of chemical research, highlighting its importance in advancing chemical science and technology.

References

2016. Isavuconazole. Pharmaceutical Substances.
URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-09-0093