| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,2,3,3,4,4,5,5-Octafluoropentyl 4-Methylbenzenesulfonate |
|---|---|
| Synonyms | 1H,1H,5H-Octafluoropentyl 4-toluenesulphonate 96%; 1H,1H,5H-Octafluoropentyl p-toluenesulfonate; 1H,1H,5H-OCTAFLUOROPENTYLP-TOLUENESULFONATE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10F8O3S |
| Molecular Weight | 386.26 |
| CAS Registry Number | 2264-00-8 |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COS(=O)(=O)c1ccc(cc1)C |
| InChI | 1S/C12H10F8O3S/c1-7-2-4-8(5-3-7)24(21,22)23-6-10(15,16)12(19,20)11(17,18)9(13)14/h2-5,9H,6H2,1H3 |
| InChIKey | ACPMGBQCNGPAAY-UHFFFAOYSA-N |
| Density | 1.463g/cm3 (Cal.) |
|---|---|
| 1.5127 (Expl.) | |
| Melting point | 8-12°C (Expl.) |
| Boiling point | 157°C (Expl.) |
| 352.698°C at 760 mmHg (Cal.) | |
| Flash point | 167.106°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.4325 (Expl.) |
| 1.415 (Cal.) | |
| Safety Description | R36/37/38 |
|---|---|
| Irritant | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5-Octafluoropentyl 4-Methylbenzenesulfonate |