Online Database of Chemicals from Around the World
|
CAS#: 34501-55-8 Product: 1a,11b-Dihydro-Benz(5,6)Anthra(1,2-b)Oxirene No suppilers available for the product. |
| Name | 1a,11b-Dihydro-Benz(5,6)Anthra(1,2-b)Oxirene |
|---|---|
| Synonyms | Benz(A)Anthracene 8,9-Oxide; Benz(A)Anthracene-8,9-Epoxide; Benzanthracene-8,9-Oxide |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 34501-55-8 |
| SMILES | C1=C4C(=CC2=C1C=CC3OC23)C=CC5=C4C=CC=C5 |
| InChI | 1S/C18H12O/c1-2-4-14-11(3-1)5-6-12-10-16-13(9-15(12)14)7-8-17-18(16)19-17/h1-10,17-18H |
| InChIKey | SVKZFXAHKUJFBQ-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.743°C at 760 mmHg (Cal.) |
| Flash point | 226.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a,11b-Dihydro-Benz(5,6)Anthra(1,2-b)Oxirene |